C13H11Cl2N3O — CID 114420721
5-amino-3-but-3-yn-2-yl-4-(2,3-dichlorophenyl)-4H-imidazol-2-one (PubChem CID 114420721) has the molecular formula C13H11Cl2N3O and a molecular weight of 296.16 g/mol. Its IUPAC name is 5-amino-3-but-3-yn-2-yl-4-(2,3-dichlorophenyl)-4H-imidazol-2-one.
| Compound Name | 5-amino-3-but-3-yn-2-yl-4-(2,3-dichlorophenyl)-4H-imidazol-2-one |
|---|---|
| PubChem CID | 114420721 |
| Molecular Formula | C13H11Cl2N3O |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 5-amino-3-but-3-yn-2-yl-4-(2,3-dichlorophenyl)-4H-imidazol-2-one |
| SMILES | C#CC(C)N1C(=O)N=C(N)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C13H11Cl2N3O/c1-3-7(2)18-11(12(16)17-13(18)19)8-5-4-6-9(14)10(8)15/h1,4-7,11H,2H3,(H2,16,17,19) |
| InChIKey | OPUMZLKXDIXFSP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|