C15H17Cl2NO3 — CID 114427256
1-(2,3-dichlorobenzoyl)-4-ethylpiperidine-2-carboxylic acid (PubChem CID 114427256) has the molecular formula C15H17Cl2NO3 and a molecular weight of 330.21 g/mol. Its IUPAC name is 1-(2,3-dichlorobenzoyl)-4-ethylpiperidine-2-carboxylic acid.
| Compound Name | 1-(2,3-dichlorobenzoyl)-4-ethylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 114427256 |
| Molecular Formula | C15H17Cl2NO3 |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 1-(2,3-dichlorobenzoyl)-4-ethylpiperidine-2-carboxylic acid |
| SMILES | CCC1CCN(C(=O)c2cccc(Cl)c2Cl)C(C(=O)O)C1 |
| InChI | InChI=1S/C15H17Cl2NO3/c1-2-9-6-7-18(12(8-9)15(20)21)14(19)10-4-3-5-11(16)13(10)17/h3-5,9,12H,2,6-8H2,1H3,(H,20,21) |
| InChIKey | HCVJABYAFCCXMT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |