C28H39NO6 — CID 11443125
methyl (2R,3R,3aS)-2-[(5S,9R)-7-(2-phenylmethoxyethyl)-6,8-dioxatricyclo[7.3.0.01,5]dodecan-7-yl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate (PubChem CID 11443125) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol. Its IUPAC name is methyl (2R,3R,3aS)-2-[(5S,9R)-7-(2-phenylmethoxyethyl)-6,8-dioxatricyclo[7.3.0.01,5]dodecan-7-yl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate.
| Compound Name | methyl (2R,3R,3aS)-2-[(5S,9R)-7-(2-phenylmethoxyethyl)-6,8-dioxatricyclo[7.3.0.01,5]dodecan-7-yl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 11443125 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | methyl (2R,3R,3aS)-2-[(5S,9R)-7-(2-phenylmethoxyethyl)-6,8-dioxatricyclo[7.3.0.01,5]dodecan-7-yl]-3,3a,4,5,6,7-hexahydro-2H-[1,2]oxazolo[2,3-a]pyridine-3-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](C2(CCOCc3ccccc3)O[C@H]3CCCC34CCC[C@H]4O2)ON2CCCC[C@@H]12 |
| InChI | InChI=1S/C28H39NO6/c1-31-26(30)24-21-11-5-6-17-29(21)35-25(24)28(16-18-32-19-20-9-3-2-4-10-20)33-22-12-7-14-27(22)15-8-13-23(27)34-28/h2-4,9-10,21-25H,5-8,11-19H2,1H3/t21-,22-,23+,24+,25+,27?,28?/m0/s1 |
| InChIKey | MKNIQZJQMFOVNW-AQQOCKDBSA-N |
| XLogP | 4.39 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|