C13H16ClN5O2 — CID 114435921
4-chloro-5-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-2-prop-2-enylpyridazin-3-one (PubChem CID 114435921) has the molecular formula C13H16ClN5O2 and a molecular weight of 309.76 g/mol. Its IUPAC name is 4-chloro-5-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-chloro-5-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114435921 |
| Molecular Formula | C13H16ClN5O2 |
| Molecular Weight | 309.76 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 4-chloro-5-[[1-(2-methoxyethyl)pyrazol-4-yl]amino]-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(Nc2cnn(CCOC)c2)c(Cl)c1=O |
| InChI | InChI=1S/C13H16ClN5O2/c1-3-4-19-13(20)12(14)11(8-16-19)17-10-7-15-18(9-10)5-6-21-2/h3,7-9,17H,1,4-6H2,2H3 |
| InChIKey | QPECBHTUKMFAFB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.76 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|