C13H19ClN6O — CID 114433450
4-chloro-2-[2-(dimethylamino)ethyl]-5-[(1-ethylpyrazol-4-yl)amino]pyridazin-3-one (PubChem CID 114433450) has the molecular formula C13H19ClN6O and a molecular weight of 310.79 g/mol. Its IUPAC name is 4-chloro-2-[2-(dimethylamino)ethyl]-5-[(1-ethylpyrazol-4-yl)amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-[(1-ethylpyrazol-4-yl)amino]pyridazin-3-one |
|---|---|
| PubChem CID | 114433450 |
| Molecular Formula | C13H19ClN6O |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 4-chloro-2-[2-(dimethylamino)ethyl]-5-[(1-ethylpyrazol-4-yl)amino]pyridazin-3-one |
| SMILES | CCn1cc(Nc2cnn(CCN(C)C)c(=O)c2Cl)cn1 |
| InChI | InChI=1S/C13H19ClN6O/c1-4-19-9-10(7-15-19)17-11-8-16-20(6-5-18(2)3)13(21)12(11)14/h7-9,17H,4-6H2,1-3H3 |
| InChIKey | PKAATGWVMMZIKW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |