C14H15Br2N3OS — CID 114438582
5-bromo-4-[(4-bromothiophen-2-yl)methylamino]-2-(cyclobutylmethyl)pyridazin-3-one (PubChem CID 114438582) has the molecular formula C14H15Br2N3OS and a molecular weight of 433.17 g/mol. Its IUPAC name is 5-bromo-4-[(4-bromothiophen-2-yl)methylamino]-2-(cyclobutylmethyl)pyridazin-3-one.
| Compound Name | 5-bromo-4-[(4-bromothiophen-2-yl)methylamino]-2-(cyclobutylmethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114438582 |
| Molecular Formula | C14H15Br2N3OS |
| Molecular Weight | 433.17 g/mol |
| Exact Mass | 430.93 |
| IUPAC Name | 5-bromo-4-[(4-bromothiophen-2-yl)methylamino]-2-(cyclobutylmethyl)pyridazin-3-one |
| SMILES | O=c1c(NCc2cc(Br)cs2)c(Br)cnn1CC1CCC1 |
| InChI | InChI=1S/C14H15Br2N3OS/c15-10-4-11(21-8-10)5-17-13-12(16)6-18-19(14(13)20)7-9-2-1-3-9/h4,6,8-9,17H,1-3,5,7H2 |
| InChIKey | BZLPPPUUCTWDIH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |