C14H18ClN3O — CID 114440151
5-chloro-4-[(2,2-dimethylcyclopentyl)amino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 114440151) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 5-chloro-4-[(2,2-dimethylcyclopentyl)amino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 5-chloro-4-[(2,2-dimethylcyclopentyl)amino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114440151 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 5-chloro-4-[(2,2-dimethylcyclopentyl)amino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(Cl)c(NC2CCCC2(C)C)c1=O |
| InChI | InChI=1S/C14H18ClN3O/c1-4-8-18-13(19)12(10(15)9-16-18)17-11-6-5-7-14(11,2)3/h1,9,11,17H,5-8H2,2-3H3 |
| InChIKey | HXWNHJMCLDPGMQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|