C11H14ClN3O4 — CID 107851292
5-chloro-4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 107851292) has the molecular formula C11H14ClN3O4 and a molecular weight of 287.70 g/mol. Its IUPAC name is 5-chloro-4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 5-chloro-4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 107851292 |
| Molecular Formula | C11H14ClN3O4 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-chloro-4-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(Cl)c(NC(CO)(CO)CO)c1=O |
| InChI | InChI=1S/C11H14ClN3O4/c1-2-3-15-10(19)9(8(12)4-13-15)14-11(5-16,6-17)7-18/h1,4,14,16-18H,3,5-7H2 |
| InChIKey | JJPKGPGLJVRPFA-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|