C14H20ClN3O2 — CID 107153197
5-chloro-4-[(2-hydroxy-4,4-dimethylpentyl)amino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 107153197) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 5-chloro-4-[(2-hydroxy-4,4-dimethylpentyl)amino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 5-chloro-4-[(2-hydroxy-4,4-dimethylpentyl)amino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 107153197 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 5-chloro-4-[(2-hydroxy-4,4-dimethylpentyl)amino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(Cl)c(NCC(O)CC(C)(C)C)c1=O |
| InChI | InChI=1S/C14H20ClN3O2/c1-5-6-18-13(20)12(11(15)9-17-18)16-8-10(19)7-14(2,3)4/h1,9-10,16,19H,6-8H2,2-4H3 |
| InChIKey | JYAJXXZIWTXHQF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|