C10H12ClN3O — CID 114431283
5-chloro-4-(propylamino)-2-prop-2-ynylpyridazin-3-one (PubChem CID 114431283) has the molecular formula C10H12ClN3O and a molecular weight of 225.68 g/mol. Its IUPAC name is 5-chloro-4-(propylamino)-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 5-chloro-4-(propylamino)-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114431283 |
| Molecular Formula | C10H12ClN3O |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 5-chloro-4-(propylamino)-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(Cl)c(NCCC)c1=O |
| InChI | InChI=1S/C10H12ClN3O/c1-3-5-12-9-8(11)7-13-14(6-4-2)10(9)15/h2,7,12H,3,5-6H2,1H3 |
| InChIKey | UEDKJJAKJNXULU-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|