C10H12ClN3O2S — CID 114442355
5-chloro-4-(2-methylsulfinylethylamino)-2-prop-2-ynylpyridazin-3-one (PubChem CID 114442355) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.74 g/mol. Its IUPAC name is 5-chloro-4-(2-methylsulfinylethylamino)-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 5-chloro-4-(2-methylsulfinylethylamino)-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114442355 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | 5-chloro-4-(2-methylsulfinylethylamino)-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(Cl)c(NCCS(C)=O)c1=O |
| InChI | InChI=1S/C10H12ClN3O2S/c1-3-5-14-10(15)9(8(11)7-13-14)12-4-6-17(2)16/h1,7,12H,4-6H2,2H3 |
| InChIKey | YXTDHQNBXBMSQA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|