C13H19ClN4O — CID 114436161
5-chloro-4-[[2-(dimethylamino)-2-methylpropyl]amino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 114436161) has the molecular formula C13H19ClN4O and a molecular weight of 282.78 g/mol. Its IUPAC name is 5-chloro-4-[[2-(dimethylamino)-2-methylpropyl]amino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 5-chloro-4-[[2-(dimethylamino)-2-methylpropyl]amino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114436161 |
| Molecular Formula | C13H19ClN4O |
| Molecular Weight | 282.78 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 5-chloro-4-[[2-(dimethylamino)-2-methylpropyl]amino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(Cl)c(NCC(C)(C)N(C)C)c1=O |
| InChI | InChI=1S/C13H19ClN4O/c1-6-7-18-12(19)11(10(14)8-16-18)15-9-13(2,3)17(4)5/h1,8,15H,7,9H2,2-5H3 |
| InChIKey | RTHVFLJXPUMBAY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.78 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|