C14H19ClN4O — CID 114436217
5-chloro-4-[(1-methylpiperidin-4-yl)methylamino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 114436217) has the molecular formula C14H19ClN4O and a molecular weight of 294.79 g/mol. Its IUPAC name is 5-chloro-4-[(1-methylpiperidin-4-yl)methylamino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 5-chloro-4-[(1-methylpiperidin-4-yl)methylamino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114436217 |
| Molecular Formula | C14H19ClN4O |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-chloro-4-[(1-methylpiperidin-4-yl)methylamino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(Cl)c(NCC2CCN(C)CC2)c1=O |
| InChI | InChI=1S/C14H19ClN4O/c1-3-6-19-14(20)13(12(15)10-17-19)16-9-11-4-7-18(2)8-5-11/h1,10-11,16H,4-9H2,2H3 |
| InChIKey | MDCIRZGNNPQBIP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|