C11H11ClF3N3O — CID 114440826
5-chloro-2-prop-2-ynyl-4-(4,4,4-trifluorobutylamino)pyridazin-3-one (PubChem CID 114440826) has the molecular formula C11H11ClF3N3O and a molecular weight of 293.68 g/mol. Its IUPAC name is 5-chloro-2-prop-2-ynyl-4-(4,4,4-trifluorobutylamino)pyridazin-3-one.
| Compound Name | 5-chloro-2-prop-2-ynyl-4-(4,4,4-trifluorobutylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114440826 |
| Molecular Formula | C11H11ClF3N3O |
| Molecular Weight | 293.68 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-chloro-2-prop-2-ynyl-4-(4,4,4-trifluorobutylamino)pyridazin-3-one |
| SMILES | C#CCn1ncc(Cl)c(NCCCC(F)(F)F)c1=O |
| InChI | InChI=1S/C11H11ClF3N3O/c1-2-6-18-10(19)9(8(12)7-17-18)16-5-3-4-11(13,14)15/h1,7,16H,3-6H2 |
| InChIKey | GBDVXZQMQYXSHJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.68 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|