C11H12ClN3O3S — CID 114432304
5-chloro-4-[(1,1-dioxothiolan-3-yl)amino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 114432304) has the molecular formula C11H12ClN3O3S and a molecular weight of 301.76 g/mol. Its IUPAC name is 5-chloro-4-[(1,1-dioxothiolan-3-yl)amino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 5-chloro-4-[(1,1-dioxothiolan-3-yl)amino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114432304 |
| Molecular Formula | C11H12ClN3O3S |
| Molecular Weight | 301.76 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 5-chloro-4-[(1,1-dioxothiolan-3-yl)amino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(Cl)c(NC2CCS(=O)(=O)C2)c1=O |
| InChI | InChI=1S/C11H12ClN3O3S/c1-2-4-15-11(16)10(9(12)6-13-15)14-8-3-5-19(17,18)7-8/h1,6,8,14H,3-5,7H2 |
| InChIKey | JSECPMZXEPQDPB-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.76 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|