C14H18ClN5O — CID 114440953
5-chloro-2-(cyclobutylmethyl)-4-[(1-methylpyrazol-3-yl)methylamino]pyridazin-3-one (PubChem CID 114440953) has the molecular formula C14H18ClN5O and a molecular weight of 307.79 g/mol. Its IUPAC name is 5-chloro-2-(cyclobutylmethyl)-4-[(1-methylpyrazol-3-yl)methylamino]pyridazin-3-one.
| Compound Name | 5-chloro-2-(cyclobutylmethyl)-4-[(1-methylpyrazol-3-yl)methylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114440953 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 5-chloro-2-(cyclobutylmethyl)-4-[(1-methylpyrazol-3-yl)methylamino]pyridazin-3-one |
| SMILES | Cn1ccc(CNc2c(Cl)cnn(CC3CCC3)c2=O)n1 |
| InChI | InChI=1S/C14H18ClN5O/c1-19-6-5-11(18-19)7-16-13-12(15)8-17-20(14(13)21)9-10-3-2-4-10/h5-6,8,10,16H,2-4,7,9H2,1H3 |
| InChIKey | GFUJWDVHDMABMJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |