C14H15BrN4OS — CID 114441358
4-bromo-5-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 114441358) has the molecular formula C14H15BrN4OS and a molecular weight of 367.27 g/mol. Its IUPAC name is 4-bromo-5-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 4-bromo-5-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114441358 |
| Molecular Formula | C14H15BrN4OS |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 4-bromo-5-[1-(5-ethyl-1,3-thiazol-2-yl)ethylamino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(NC(C)c2ncc(CC)s2)c(Br)c1=O |
| InChI | InChI=1S/C14H15BrN4OS/c1-4-6-19-14(20)12(15)11(8-17-19)18-9(3)13-16-7-10(5-2)21-13/h1,7-9,18H,5-6H2,2-3H3 |
| InChIKey | MOVFLEDJNUIGCK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|