C12H16BrN3O2S — CID 106162164
4-bromo-5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-prop-2-ynylpyridazin-3-one (PubChem CID 106162164) has the molecular formula C12H16BrN3O2S and a molecular weight of 346.25 g/mol. Its IUPAC name is 4-bromo-5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 106162164 |
| Molecular Formula | C12H16BrN3O2S |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 4-bromo-5-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(NC(C)C(CO)SC)c(Br)c1=O |
| InChI | InChI=1S/C12H16BrN3O2S/c1-4-5-16-12(18)11(13)9(6-14-16)15-8(2)10(7-17)19-3/h1,6,8,10,15,17H,5,7H2,2-3H3 |
| InChIKey | YNFTVRWLMIXVJE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|