C14H14BrN3OS — CID 114435559
4-bromo-2-prop-2-ynyl-5-(1-thiophen-3-ylpropan-2-ylamino)pyridazin-3-one (PubChem CID 114435559) has the molecular formula C14H14BrN3OS and a molecular weight of 352.26 g/mol. Its IUPAC name is 4-bromo-2-prop-2-ynyl-5-(1-thiophen-3-ylpropan-2-ylamino)pyridazin-3-one.
| Compound Name | 4-bromo-2-prop-2-ynyl-5-(1-thiophen-3-ylpropan-2-ylamino)pyridazin-3-one |
|---|---|
| PubChem CID | 114435559 |
| Molecular Formula | C14H14BrN3OS |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 4-bromo-2-prop-2-ynyl-5-(1-thiophen-3-ylpropan-2-ylamino)pyridazin-3-one |
| SMILES | C#CCn1ncc(NC(C)Cc2ccsc2)c(Br)c1=O |
| InChI | InChI=1S/C14H14BrN3OS/c1-3-5-18-14(19)13(15)12(8-16-18)17-10(2)7-11-4-6-20-9-11/h1,4,6,8-10,17H,5,7H2,2H3 |
| InChIKey | IDXYZFOHQUSMRN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|