C12H15ClN6O — CID 114441727
5-chloro-2-(cyclopropylmethyl)-4-[2-(triazol-1-yl)ethylamino]pyridazin-3-one (PubChem CID 114441727) has the molecular formula C12H15ClN6O and a molecular weight of 294.75 g/mol. Its IUPAC name is 5-chloro-2-(cyclopropylmethyl)-4-[2-(triazol-1-yl)ethylamino]pyridazin-3-one.
| Compound Name | 5-chloro-2-(cyclopropylmethyl)-4-[2-(triazol-1-yl)ethylamino]pyridazin-3-one |
|---|---|
| PubChem CID | 114441727 |
| Molecular Formula | C12H15ClN6O |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-chloro-2-(cyclopropylmethyl)-4-[2-(triazol-1-yl)ethylamino]pyridazin-3-one |
| SMILES | O=c1c(NCCn2ccnn2)c(Cl)cnn1CC1CC1 |
| InChI | InChI=1S/C12H15ClN6O/c13-10-7-16-19(8-9-1-2-9)12(20)11(10)14-3-5-18-6-4-15-17-18/h4,6-7,9,14H,1-3,5,8H2 |
| InChIKey | SNAPNZGZNPOGIU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |