C12H14BrN3OS2 — CID 114442684
4-bromo-5-(1,4-dithian-2-ylmethylamino)-2-prop-2-ynylpyridazin-3-one (PubChem CID 114442684) has the molecular formula C12H14BrN3OS2 and a molecular weight of 360.30 g/mol. Its IUPAC name is 4-bromo-5-(1,4-dithian-2-ylmethylamino)-2-prop-2-ynylpyridazin-3-one.
| Compound Name | 4-bromo-5-(1,4-dithian-2-ylmethylamino)-2-prop-2-ynylpyridazin-3-one |
|---|---|
| PubChem CID | 114442684 |
| Molecular Formula | C12H14BrN3OS2 |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | 4-bromo-5-(1,4-dithian-2-ylmethylamino)-2-prop-2-ynylpyridazin-3-one |
| SMILES | C#CCn1ncc(NCC2CSCCS2)c(Br)c1=O |
| InChI | InChI=1S/C12H14BrN3OS2/c1-2-3-16-12(17)11(13)10(7-15-16)14-6-9-8-18-4-5-19-9/h1,7,9,14H,3-6,8H2 |
| InChIKey | CMWAPMQHQPQWQJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|