C12H10ClF3N4O — CID 114444736
5-(4-aminoanilino)-4-chloro-2-(2,2,2-trifluoroethyl)pyridazin-3-one (PubChem CID 114444736) has the molecular formula C12H10ClF3N4O and a molecular weight of 318.69 g/mol. Its IUPAC name is 5-(4-aminoanilino)-4-chloro-2-(2,2,2-trifluoroethyl)pyridazin-3-one.
| Compound Name | 5-(4-aminoanilino)-4-chloro-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114444736 |
| Molecular Formula | C12H10ClF3N4O |
| Molecular Weight | 318.69 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 5-(4-aminoanilino)-4-chloro-2-(2,2,2-trifluoroethyl)pyridazin-3-one |
| SMILES | Nc1ccc(Nc2cnn(CC(F)(F)F)c(=O)c2Cl)cc1 |
| InChI | InChI=1S/C12H10ClF3N4O/c13-10-9(19-8-3-1-7(17)2-4-8)5-18-20(11(10)21)6-12(14,15)16/h1-5,19H,6,17H2 |
| InChIKey | XZVDYVUMHRGSGF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|