C14H21BrN4O2 — CID 114445235
4-bromo-5-(2-piperidin-4-yloxyethylamino)-2-prop-2-enylpyridazin-3-one (PubChem CID 114445235) has the molecular formula C14H21BrN4O2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 4-bromo-5-(2-piperidin-4-yloxyethylamino)-2-prop-2-enylpyridazin-3-one.
| Compound Name | 4-bromo-5-(2-piperidin-4-yloxyethylamino)-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114445235 |
| Molecular Formula | C14H21BrN4O2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 4-bromo-5-(2-piperidin-4-yloxyethylamino)-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(NCCOC2CCNCC2)c(Br)c1=O |
| InChI | InChI=1S/C14H21BrN4O2/c1-2-8-19-14(20)13(15)12(10-18-19)17-7-9-21-11-3-5-16-6-4-11/h2,10-11,16-17H,1,3-9H2 |
| InChIKey | MEFGZYVZFOYFRQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|