C36H44O6 — CID 11444524
(3aR,5R,7aR)-5-[(1R,6S)-1,6,8-tris(phenylmethoxy)octyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one (PubChem CID 11444524) has the molecular formula C36H44O6 and a molecular weight of 572.74 g/mol. Its IUPAC name is (3aR,5R,7aR)-5-[(1R,6S)-1,6,8-tris(phenylmethoxy)octyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one.
| Compound Name | (3aR,5R,7aR)-5-[(1R,6S)-1,6,8-tris(phenylmethoxy)octyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 11444524 |
| Molecular Formula | C36H44O6 |
| Molecular Weight | 572.74 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | (3aR,5R,7aR)-5-[(1R,6S)-1,6,8-tris(phenylmethoxy)octyl]-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-one |
| SMILES | O=C1C[C@H]2O[C@@H]([C@@H](CCCC[C@@H](CCOCc3ccccc3)OCc3ccccc3)OCc3ccccc3)CC[C@H]2O1 |
| InChI | InChI=1S/C36H44O6/c37-36-24-35-34(42-36)21-20-33(41-35)32(40-27-30-16-8-3-9-17-30)19-11-10-18-31(39-26-29-14-6-2-7-15-29)22-23-38-25-28-12-4-1-5-13-28/h1-9,12-17,31-35H,10-11,18-27H2/t31-,32+,33+,34+,35+/m0/s1 |
| InChIKey | WWUFWPWFWZMYTC-IVSKGHNCSA-N |
| XLogP | 7.19 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.74 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|