C32H50O9 — CID 11444592
2-[2-[2-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethoxy]ethoxy]ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 11444592) has the molecular formula C32H50O9 and a molecular weight of 578.74 g/mol. Its IUPAC name is 2-[2-[2-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethoxy]ethoxy]ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | 2-[2-[2-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethoxy]ethoxy]ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 11444592 |
| Molecular Formula | C32H50O9 |
| Molecular Weight | 578.74 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | 2-[2-[2-[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyethoxy]ethoxy]ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OCCOCCOCCO[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)C(C)(C)CCC1 |
| InChI | InChI=1S/C32H50O9/c1-22(12-13-26-24(3)11-8-14-32(26,5)6)9-7-10-23(2)21-27(33)39-19-17-37-15-16-38-18-20-40-31-30(36)29(35)28(34)25(4)41-31/h7,9-10,12-13,21,25,28-31,34-36H,8,11,14-20H2,1-6H3/b10-7+,13-12+,22-9+,23-21+/t25-,28-,29+,30+,31+/m0/s1 |
| InChIKey | VFWMSCAYXMYNJW-RUQFIDIESA-N |
| XLogP | 3.94 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.74 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|