C14H23BrN4O — CID 114447008
5-[(3-amino-4-methylpentyl)-methylamino]-4-bromo-2-prop-2-enylpyridazin-3-one (PubChem CID 114447008) has the molecular formula C14H23BrN4O and a molecular weight of 343.27 g/mol. Its IUPAC name is 5-[(3-amino-4-methylpentyl)-methylamino]-4-bromo-2-prop-2-enylpyridazin-3-one.
| Compound Name | 5-[(3-amino-4-methylpentyl)-methylamino]-4-bromo-2-prop-2-enylpyridazin-3-one |
|---|---|
| PubChem CID | 114447008 |
| Molecular Formula | C14H23BrN4O |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 5-[(3-amino-4-methylpentyl)-methylamino]-4-bromo-2-prop-2-enylpyridazin-3-one |
| SMILES | C=CCn1ncc(N(C)CCC(N)C(C)C)c(Br)c1=O |
| InChI | InChI=1S/C14H23BrN4O/c1-5-7-19-14(20)13(15)12(9-17-19)18(4)8-6-11(16)10(2)3/h5,9-11H,1,6-8,16H2,2-4H3 |
| InChIKey | FOZKLOIIIZZXBC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|