C12H22BrN5O — CID 114447043
5-[3-aminopropyl(methyl)amino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one (PubChem CID 114447043) has the molecular formula C12H22BrN5O and a molecular weight of 332.25 g/mol. Its IUPAC name is 5-[3-aminopropyl(methyl)amino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one.
| Compound Name | 5-[3-aminopropyl(methyl)amino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
|---|---|
| PubChem CID | 114447043 |
| Molecular Formula | C12H22BrN5O |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 5-[3-aminopropyl(methyl)amino]-4-bromo-2-[2-(dimethylamino)ethyl]pyridazin-3-one |
| SMILES | CN(C)CCn1ncc(N(C)CCCN)c(Br)c1=O |
| InChI | InChI=1S/C12H22BrN5O/c1-16(2)7-8-18-12(19)11(13)10(9-15-18)17(3)6-4-5-14/h9H,4-8,14H2,1-3H3 |
| InChIKey | DKICDZHKVZVPSW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |