C33H58O7Si — CID 11444739
(2R,3S,4S,5S,6E,8S,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxymethyl)-3-[(4-methoxyphenyl)methoxy]-2,6,8-trimethylundeca-6,9-dien-1-ol (PubChem CID 11444739) has the molecular formula C33H58O7Si and a molecular weight of 594.91 g/mol. Its IUPAC name is (2R,3S,4S,5S,6E,8S,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxymethyl)-3-[(4-methoxyphenyl)methoxy]-2,6,8-trimethylundeca-6,9-dien-1-ol.
| Compound Name | (2R,3S,4S,5S,6E,8S,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxymethyl)-3-[(4-methoxyphenyl)methoxy]-2,6,8-trimethylundeca-6,9-dien-1-ol |
|---|---|
| PubChem CID | 11444739 |
| Molecular Formula | C33H58O7Si |
| Molecular Weight | 594.91 g/mol |
| Exact Mass | 594.40 |
| IUPAC Name | (2R,3S,4S,5S,6E,8S,9Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxymethyl)-3-[(4-methoxyphenyl)methoxy]-2,6,8-trimethylundeca-6,9-dien-1-ol |
| SMILES | C/C=C\[C@H](C)/C=C(\C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](COCOCCOC)[C@@H](OCc1ccc(OC)cc1)[C@H](C)CO |
| InChI | InChI=1S/C33H58O7Si/c1-12-13-25(2)20-26(3)32(40-41(10,11)33(5,6)7)30(23-38-24-37-19-18-35-8)31(27(4)21-34)39-22-28-14-16-29(36-9)17-15-28/h12-17,20,25,27,30-32,34H,18-19,21-24H2,1-11H3/b13-12-,26-20+/t25-,27+,30-,31-,32+/m0/s1 |
| InChIKey | RCUPXTNWOKHWGK-YHQYXZGESA-N |
| XLogP | 7.01 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.91 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|