C14H16N4O — CID 114455649
1-(7-amino-2,3-dihydroindol-1-yl)-2-pyrazol-1-ylpropan-1-one (PubChem CID 114455649) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-(7-amino-2,3-dihydroindol-1-yl)-2-pyrazol-1-ylpropan-1-one.
| Compound Name | 1-(7-amino-2,3-dihydroindol-1-yl)-2-pyrazol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 114455649 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 1-(7-amino-2,3-dihydroindol-1-yl)-2-pyrazol-1-ylpropan-1-one |
| SMILES | CC(C(=O)N1CCc2cccc(N)c21)n1cccn1 |
| InChI | InChI=1S/C14H16N4O/c1-10(18-8-3-7-16-18)14(19)17-9-6-11-4-2-5-12(15)13(11)17/h2-5,7-8,10H,6,9,15H2,1H3 |
| InChIKey | DFWZBWDXAXSHPA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|