About (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone
(7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone (PubChem CID 114455856) has the molecular formula C13H11N3O3S
and a molecular weight of 289.32 g/mol. Its IUPAC name is (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone.
Molecular Properties
| Compound Name | (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone |
| PubChem CID | 114455856 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone |
| SMILES | Nc1cccc2c1N(C(=O)c1ccc([N+](=O)[O-])s1)CC2 |
| InChI | InChI=1S/C13H11N3O3S/c14-9-3-1-2-8-6-7-15(12(8)9)13(17)10-4-5-11(20-10)16(18)19/h1-5H,6-7,14H2 |
| InChIKey | JHTACZXUQOJXFX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone?
The IUPAC name of (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone (CID 114455856) is (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone.
What is the SMILES notation for (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone?
The canonical SMILES for (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone is Nc1cccc2c1N(C(=O)c1ccc([N+](=O)[O-])s1)CC2.
What is the InChIKey of (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone?
The InChIKey is JHTACZXUQOJXFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O3S/c14-9-3-1-2-8-6-7-15(12(8)9)13(17)10-4-5-11(20-10)16(18)19/h1-5H,6-7,14H2.
What are the key properties of (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone?
(7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone has a molecular weight of 289.32 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7-amino-2,3-dihydroindol-1-yl)-(5-nitrothiophen-2-yl)methanone is sourced from PubChem (CID 114455856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).