C16H22N2O — CID 114456497
1-(5-oxaspiro[3.5]nonan-8-yl)-2,3-dihydroindol-7-amine (PubChem CID 114456497) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is 1-(5-oxaspiro[3.5]nonan-8-yl)-2,3-dihydroindol-7-amine.
| Compound Name | 1-(5-oxaspiro[3.5]nonan-8-yl)-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 114456497 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 1-(5-oxaspiro[3.5]nonan-8-yl)-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(C1CCOC3(CCC3)C1)CC2 |
| InChI | InChI=1S/C16H22N2O/c17-14-4-1-3-12-5-9-18(15(12)14)13-6-10-19-16(11-13)7-2-8-16/h1,3-4,13H,2,5-11,17H2 |
| InChIKey | LBTFGZBXROPXIT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|