C17H25FN2O — CID 114456992
N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-2-cycloheptylacetamide (PubChem CID 114456992) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-2-cycloheptylacetamide.
| Compound Name | N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-2-cycloheptylacetamide |
|---|---|
| PubChem CID | 114456992 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-2-cycloheptylacetamide |
| SMILES | NCc1ccc(CNC(=O)CC2CCCCCC2)c(F)c1 |
| InChI | InChI=1S/C17H25FN2O/c18-16-9-14(11-19)7-8-15(16)12-20-17(21)10-13-5-3-1-2-4-6-13/h7-9,13H,1-6,10-12,19H2,(H,20,21) |
| InChIKey | PWKYSVUTPBJEMI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |