C17H23FN2O — CID 63358971
N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-2-(2-bicyclo[2.2.1]heptanyl)acetamide (PubChem CID 63358971) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-2-(2-bicyclo[2.2.1]heptanyl)acetamide.
| Compound Name | N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-2-(2-bicyclo[2.2.1]heptanyl)acetamide |
|---|---|
| PubChem CID | 63358971 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | N-[[4-(aminomethyl)-2-fluorophenyl]methyl]-2-(2-bicyclo[2.2.1]heptanyl)acetamide |
| SMILES | NCc1ccc(CNC(=O)CC2CC3CCC2C3)c(F)c1 |
| InChI | InChI=1S/C17H23FN2O/c18-16-7-12(9-19)2-4-14(16)10-20-17(21)8-15-6-11-1-3-13(15)5-11/h2,4,7,11,13,15H,1,3,5-6,8-10,19H2,(H,20,21) |
| InChIKey | BRRQHSVRTGIXPF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |