C15H21FN2O2S — CID 106064052
5-(aminomethyl)-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-fluorobenzenesulfonamide (PubChem CID 106064052) has the molecular formula C15H21FN2O2S and a molecular weight of 312.41 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-fluorobenzenesulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 106064052 |
| Molecular Formula | C15H21FN2O2S |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 5-(aminomethyl)-N-(2-bicyclo[2.2.1]heptanylmethyl)-2-fluorobenzenesulfonamide |
| SMILES | NCc1ccc(F)c(S(=O)(=O)NCC2CC3CCC2C3)c1 |
| InChI | InChI=1S/C15H21FN2O2S/c16-14-4-2-11(8-17)7-15(14)21(19,20)18-9-13-6-10-1-3-12(13)5-10/h2,4,7,10,12-13,18H,1,3,5-6,8-9,17H2 |
| InChIKey | KMIFRBJQDUORPF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |