C17H32N2 — CID 114462585
[4-tert-butyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)cyclohexyl]methanamine (PubChem CID 114462585) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is [4-tert-butyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)cyclohexyl]methanamine.
| Compound Name | [4-tert-butyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 114462585 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | [4-tert-butyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)cyclohexyl]methanamine |
| SMILES | CC1=CCN(C2CC(C(C)(C)C)CCC2CN)CC1 |
| InChI | InChI=1S/C17H32N2/c1-13-7-9-19(10-8-13)16-11-15(17(2,3)4)6-5-14(16)12-18/h7,14-16H,5-6,8-12,18H2,1-4H3 |
| InChIKey | SRZGROOWCKMRDY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|