C17H32N2 — CID 123422100
1-N-[1-(5-ethyl-3-methylcyclohexen-1-yl)ethyl]cyclohexane-1,3-diamine (PubChem CID 123422100) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 1-N-[1-(5-ethyl-3-methylcyclohexen-1-yl)ethyl]cyclohexane-1,3-diamine.
| Compound Name | 1-N-[1-(5-ethyl-3-methylcyclohexen-1-yl)ethyl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 123422100 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | 1-N-[1-(5-ethyl-3-methylcyclohexen-1-yl)ethyl]cyclohexane-1,3-diamine |
| SMILES | CCC1CC(C(C)NC2CCCC(N)C2)=CC(C)C1 |
| InChI | InChI=1S/C17H32N2/c1-4-14-8-12(2)9-15(10-14)13(3)19-17-7-5-6-16(18)11-17/h9,12-14,16-17,19H,4-8,10-11,18H2,1-3H3 |
| InChIKey | MEIYXTQSPMSDNJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|