C22H41N — CID 91120095
N-[1-(6-tert-butyl-3-methylcyclohexen-1-yl)pentan-3-yl]cyclohexanamine (PubChem CID 91120095) has the molecular formula C22H41N and a molecular weight of 319.58 g/mol. Its IUPAC name is N-[1-(6-tert-butyl-3-methylcyclohexen-1-yl)pentan-3-yl]cyclohexanamine.
| Compound Name | N-[1-(6-tert-butyl-3-methylcyclohexen-1-yl)pentan-3-yl]cyclohexanamine |
|---|---|
| PubChem CID | 91120095 |
| Molecular Formula | C22H41N |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 319.32 |
| IUPAC Name | N-[1-(6-tert-butyl-3-methylcyclohexen-1-yl)pentan-3-yl]cyclohexanamine |
| SMILES | CCC(CCC1=CC(C)CCC1C(C)(C)C)NC1CCCCC1 |
| InChI | InChI=1S/C22H41N/c1-6-19(23-20-10-8-7-9-11-20)14-13-18-16-17(2)12-15-21(18)22(3,4)5/h16-17,19-21,23H,6-15H2,1-5H3 |
| InChIKey | HXHUHLSURSLXDU-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|