C18H34N2 — CID 114462605
[4-(2-methylbutan-2-yl)-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)cyclohexyl]methanamine (PubChem CID 114462605) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is [4-(2-methylbutan-2-yl)-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)cyclohexyl]methanamine.
| Compound Name | [4-(2-methylbutan-2-yl)-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)cyclohexyl]methanamine |
|---|---|
| PubChem CID | 114462605 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | [4-(2-methylbutan-2-yl)-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)cyclohexyl]methanamine |
| SMILES | CCC(C)(C)C1CCC(CN)C(N2CC=C(C)CC2)C1 |
| InChI | InChI=1S/C18H34N2/c1-5-18(3,4)16-7-6-15(13-19)17(12-16)20-10-8-14(2)9-11-20/h8,15-17H,5-7,9-13,19H2,1-4H3 |
| InChIKey | CGGVWGXJYNNSOM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|