C11H16N2O6S2 — CID 114465520
ethyl 2-(ethoxycarbonylsulfamoylamino)-5-methylthiophene-3-carboxylate (PubChem CID 114465520) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is ethyl 2-(ethoxycarbonylsulfamoylamino)-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(ethoxycarbonylsulfamoylamino)-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 114465520 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | ethyl 2-(ethoxycarbonylsulfamoylamino)-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)NS(=O)(=O)Nc1sc(C)cc1C(=O)OCC |
| InChI | InChI=1S/C11H16N2O6S2/c1-4-18-10(14)8-6-7(3)20-9(8)12-21(16,17)13-11(15)19-5-2/h6,12H,4-5H2,1-3H3,(H,13,15) |
| InChIKey | GNCZTCCKQFEPMU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |