C13H22N2O4S2 — CID 114811418
ethyl 2-(tert-butylsulfamoylamino)-5-ethylthiophene-3-carboxylate (PubChem CID 114811418) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is ethyl 2-(tert-butylsulfamoylamino)-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(tert-butylsulfamoylamino)-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 114811418 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | ethyl 2-(tert-butylsulfamoylamino)-5-ethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H22N2O4S2/c1-6-9-8-10(12(16)19-7-2)11(20-9)14-21(17,18)15-13(3,4)5/h8,14-15H,6-7H2,1-5H3 |
| InChIKey | RXTNYEWORVVAQP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |