C12H18ClNO4S2 — CID 43654266
ethyl 2-(3-chloropropylsulfonylamino)-5-ethylthiophene-3-carboxylate (PubChem CID 43654266) has the molecular formula C12H18ClNO4S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is ethyl 2-(3-chloropropylsulfonylamino)-5-ethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-(3-chloropropylsulfonylamino)-5-ethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 43654266 |
| Molecular Formula | C12H18ClNO4S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | ethyl 2-(3-chloropropylsulfonylamino)-5-ethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CC)sc1NS(=O)(=O)CCCCl |
| InChI | InChI=1S/C12H18ClNO4S2/c1-3-9-8-10(12(15)18-4-2)11(19-9)14-20(16,17)7-5-6-13/h8,14H,3-7H2,1-2H3 |
| InChIKey | BMDZCZMHVJXVPL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|