C12H12BrNO4S3 — CID 63617527
ethyl 2-[(3-bromothiophen-2-yl)sulfonylamino]-5-methylthiophene-3-carboxylate (PubChem CID 63617527) has the molecular formula C12H12BrNO4S3 and a molecular weight of 410.34 g/mol. Its IUPAC name is ethyl 2-[(3-bromothiophen-2-yl)sulfonylamino]-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[(3-bromothiophen-2-yl)sulfonylamino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 63617527 |
| Molecular Formula | C12H12BrNO4S3 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 408.91 |
| IUPAC Name | ethyl 2-[(3-bromothiophen-2-yl)sulfonylamino]-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NS(=O)(=O)c1sccc1Br |
| InChI | InChI=1S/C12H12BrNO4S3/c1-3-18-11(15)8-6-7(2)20-10(8)14-21(16,17)12-9(13)4-5-19-12/h4-6,14H,3H2,1-2H3 |
| InChIKey | IYSBKSWIHPMDIY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |