C13H17N — CID 11446790
2-tert-butyl-3,3a-dihydrocyclohepta[b]pyrrole (PubChem CID 11446790) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 2-tert-butyl-3,3a-dihydrocyclohepta[b]pyrrole.
| Compound Name | 2-tert-butyl-3,3a-dihydrocyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 11446790 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2-tert-butyl-3,3a-dihydrocyclohepta[b]pyrrole |
| SMILES | CC(C)(C)C1=NC2=CC=CC=CC2C1 |
| InChI | InChI=1S/C13H17N/c1-13(2,3)12-9-10-7-5-4-6-8-11(10)14-12/h4-8,10H,9H2,1-3H3 |
| InChIKey | GZANYMOUACYCOT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |