About 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene
9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene (PubChem CID 143027531) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene.
Analyze 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene?
The IUPAC name of 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene (CID 143027531) is 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene.
What is the SMILES notation for 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene?
The canonical SMILES for 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene is CC1=NC2=CC=CC3CC23C1(C)C.
What is the InChIKey of 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene?
The InChIKey is LYYODRQFDAFGET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-8-11(2,3)12-7-9(12)5-4-6-10(12)13-8/h4-6,9H,7H2,1-3H3.
What are the key properties of 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene?
9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene has a molecular weight of 173.26 g/mol, XLogP of 2.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10,10-trimethyl-8-azatricyclo[5.3.0.01,3]deca-4,6,8-triene is sourced from PubChem (CID 143027531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).