C11H11NNa+ — CID 162475748
sodium 3,3-dimethyl-2-methylidene-5H-indol-3a-ylium-5-ide (PubChem CID 162475748) has the molecular formula C11H11NNa+ and a molecular weight of 180.21 g/mol. Its IUPAC name is sodium 3,3-dimethyl-2-methylidene-5H-indol-3a-ylium-5-ide.
| Compound Name | sodium 3,3-dimethyl-2-methylidene-5H-indol-3a-ylium-5-ide |
|---|---|
| PubChem CID | 162475748 |
| Molecular Formula | C11H11NNa+ |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | sodium 3,3-dimethyl-2-methylidene-5H-indol-3a-ylium-5-ide |
| SMILES | C=C1N=C2C=C[C-]=C[C+]2C1(C)C.[Na+] |
| InChI | InChI=1S/C11H11N.Na/c1-8-11(2,3)9-6-4-5-7-10(9)12-8;/h5-7H,1H2,2-3H3;/q;+1 |
| InChIKey | QVEITORQTCCODH-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|