C14H17N — CID 151018697
6,6-dimethyl-1,4,5,7-tetrahydrocarbazole (PubChem CID 151018697) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 6,6-dimethyl-1,4,5,7-tetrahydrocarbazole.
| Compound Name | 6,6-dimethyl-1,4,5,7-tetrahydrocarbazole |
|---|---|
| PubChem CID | 151018697 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 6,6-dimethyl-1,4,5,7-tetrahydrocarbazole |
| SMILES | CC1(C)CC=C2N=C3CC=CCC3=C2C1 |
| InChI | InChI=1S/C14H17N/c1-14(2)8-7-13-11(9-14)10-5-3-4-6-12(10)15-13/h3-4,7H,5-6,8-9H2,1-2H3 |
| InChIKey | LXPYEEMRYVXLIH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|