C8H12N2O2S — CID 114470392
[5-(3-methylbut-3-enoxy)-1,3,4-thiadiazol-2-yl]methanol (PubChem CID 114470392) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is [5-(3-methylbut-3-enoxy)-1,3,4-thiadiazol-2-yl]methanol.
| Compound Name | [5-(3-methylbut-3-enoxy)-1,3,4-thiadiazol-2-yl]methanol |
|---|---|
| PubChem CID | 114470392 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | [5-(3-methylbut-3-enoxy)-1,3,4-thiadiazol-2-yl]methanol |
| SMILES | C=C(C)CCOc1nnc(CO)s1 |
| InChI | InChI=1S/C8H12N2O2S/c1-6(2)3-4-12-8-10-9-7(5-11)13-8/h11H,1,3-5H2,2H3 |
| InChIKey | BISCKVKPSBGEFJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|