C12H14N2O2S — CID 80619347
[5-(3-phenylpropoxy)-1,3,4-thiadiazol-2-yl]methanol (PubChem CID 80619347) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is [5-(3-phenylpropoxy)-1,3,4-thiadiazol-2-yl]methanol.
| Compound Name | [5-(3-phenylpropoxy)-1,3,4-thiadiazol-2-yl]methanol |
|---|---|
| PubChem CID | 80619347 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | [5-(3-phenylpropoxy)-1,3,4-thiadiazol-2-yl]methanol |
| SMILES | OCc1nnc(OCCCc2ccccc2)s1 |
| InChI | InChI=1S/C12H14N2O2S/c15-9-11-13-14-12(17-11)16-8-4-7-10-5-2-1-3-6-10/h1-3,5-6,15H,4,7-9H2 |
| InChIKey | UITJSOQFERICKE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|