C12H15NOS — CID 174637746
3-(3-phenylpropoxy)-4,5-dihydro-1,2-thiazole (PubChem CID 174637746) has the molecular formula C12H15NOS and a molecular weight of 221.33 g/mol. Its IUPAC name is 3-(3-phenylpropoxy)-4,5-dihydro-1,2-thiazole.
| Compound Name | 3-(3-phenylpropoxy)-4,5-dihydro-1,2-thiazole |
|---|---|
| PubChem CID | 174637746 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 3-(3-phenylpropoxy)-4,5-dihydro-1,2-thiazole |
| SMILES | c1ccc(CCCOC2=NSCC2)cc1 |
| InChI | InChI=1S/C12H15NOS/c1-2-5-11(6-3-1)7-4-9-14-12-8-10-15-13-12/h1-3,5-6H,4,7-10H2 |
| InChIKey | VXVZDHPOLBDALY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|