C15H22N4OS — CID 80623770
2-methyl-N-[[5-(3-pyridin-4-ylpropoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine (PubChem CID 80623770) has the molecular formula C15H22N4OS and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-methyl-N-[[5-(3-pyridin-4-ylpropoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[5-(3-pyridin-4-ylpropoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 80623770 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-methyl-N-[[5-(3-pyridin-4-ylpropoxy)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)(C)NCc1nnc(OCCCc2ccncc2)s1 |
| InChI | InChI=1S/C15H22N4OS/c1-15(2,3)17-11-13-18-19-14(21-13)20-10-4-5-12-6-8-16-9-7-12/h6-9,17H,4-5,10-11H2,1-3H3 |
| InChIKey | ONUWQWIBEBKJIF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|